About 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine
4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine (PubChem CID 79371579) has the molecular formula C14H12N4OS
and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine |
| PubChem CID | 79371579 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine |
| SMILES | COc1ccc2c(c1)-c1nc(-c3cn[nH]c3N)sc1C2 |
| InChI | InChI=1S/C14H12N4OS/c1-19-8-3-2-7-4-11-12(9(7)5-8)17-14(20-11)10-6-16-18-13(10)15/h2-3,5-6H,4H2,1H3,(H3,15,16,18) |
| InChIKey | PNYRLSVYHWQEJX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrazole_amino_B(1)', 'substructure': 'N/A'} |
|---|
Analyze 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine?
The IUPAC name of 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine (CID 79371579) is 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine.
What is the SMILES notation for 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine?
The canonical SMILES for 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine is COc1ccc2c(c1)-c1nc(-c3cn[nH]c3N)sc1C2.
What is the InChIKey of 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine?
The InChIKey is PNYRLSVYHWQEJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4OS/c1-19-8-3-2-7-4-11-12(9(7)5-8)17-14(20-11)10-6-16-18-13(10)15/h2-3,5-6H,4H2,1H3,(H3,15,16,18).
What are the key properties of 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine?
4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine has a molecular weight of 284.34 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1H-pyrazol-5-amine is sourced from PubChem (CID 79371579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).