C15H11ClN2O2S — CID 79371617
5-(chloromethyl)-14-methoxy-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11(16),12,14-hexaen-3-one (PubChem CID 79371617) has the molecular formula C15H11ClN2O2S and a molecular weight of 318.79 g/mol. Its IUPAC name is 5-(chloromethyl)-14-methoxy-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11(16),12,14-hexaen-3-one.
| Compound Name | 5-(chloromethyl)-14-methoxy-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11(16),12,14-hexaen-3-one |
|---|---|
| PubChem CID | 79371617 |
| Molecular Formula | C15H11ClN2O2S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 5-(chloromethyl)-14-methoxy-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11(16),12,14-hexaen-3-one |
| SMILES | COc1ccc2c(c1)-c1c(sc3nc(CCl)[nH]c(=O)c13)C2 |
| InChI | InChI=1S/C15H11ClN2O2S/c1-20-8-3-2-7-4-10-12(9(7)5-8)13-14(19)17-11(6-16)18-15(13)21-10/h2-3,5H,4,6H2,1H3,(H,17,18,19) |
| InChIKey | HFCZLLNWUIWJMB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|