C13H12Cl3N3O2 — CID 7937240
3,5,6-trichloro-4-[(2Z)-2-[[(1R)-cyclohex-3-en-1-yl]methylidene]hydrazinyl]pyridine-2-carboxylic acid (PubChem CID 7937240) has the molecular formula C13H12Cl3N3O2 and a molecular weight of 348.62 g/mol. Its IUPAC name is 3,5,6-trichloro-4-[(2Z)-2-[[(1R)-cyclohex-3-en-1-yl]methylidene]hydrazinyl]pyridine-2-carboxylic acid.
| Compound Name | 3,5,6-trichloro-4-[(2Z)-2-[[(1R)-cyclohex-3-en-1-yl]methylidene]hydrazinyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 7937240 |
| Molecular Formula | C13H12Cl3N3O2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 3,5,6-trichloro-4-[(2Z)-2-[[(1R)-cyclohex-3-en-1-yl]methylidene]hydrazinyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(Cl)c(Cl)c(N/N=C\[C@H]2CC=CCC2)c1Cl |
| InChI | InChI=1S/C13H12Cl3N3O2/c14-8-10(9(15)12(16)18-11(8)13(20)21)19-17-6-7-4-2-1-3-5-7/h1-2,6-7H,3-5H2,(H,18,19)(H,20,21)/b17-6-/t7-/m0/s1 |
| InChIKey | ZBUSBFJVHZTBHR-QVIJRHHCSA-N |
| XLogP | 4.49 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|