C18H20O3 — CID 79372407
2-(2,5-dimethylphenoxy)-6-methoxy-2,3-dihydro-1H-inden-1-ol (PubChem CID 79372407) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-6-methoxy-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 2-(2,5-dimethylphenoxy)-6-methoxy-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 79372407 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-6-methoxy-2,3-dihydro-1H-inden-1-ol |
| SMILES | COc1ccc2c(c1)C(O)C(Oc1cc(C)ccc1C)C2 |
| InChI | InChI=1S/C18H20O3/c1-11-4-5-12(2)16(8-11)21-17-9-13-6-7-14(20-3)10-15(13)18(17)19/h4-8,10,17-19H,9H2,1-3H3 |
| InChIKey | ZDZHYDCGHGNVSY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |