About 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane
3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane (PubChem CID 79372823) has the molecular formula C11H11Cl3O
and a molecular weight of 265.57 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane |
| PubChem CID | 79372823 |
| Molecular Formula | C11H11Cl3O |
| Molecular Weight | 265.57 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane |
| SMILES | ClCC1CCOC1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl3O/c12-6-7-4-5-15-11(7)8-2-1-3-9(13)10(8)14/h1-3,7,11H,4-6H2 |
| InChIKey | QFLKCXJRSUQJSP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane?
The IUPAC name of 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane (CID 79372823) is 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane.
What is the SMILES notation for 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane?
The canonical SMILES for 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane is ClCC1CCOC1c1cccc(Cl)c1Cl.
What is the InChIKey of 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane?
The InChIKey is QFLKCXJRSUQJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl3O/c12-6-7-4-5-15-11(7)8-2-1-3-9(13)10(8)14/h1-3,7,11H,4-6H2.
What are the key properties of 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane?
3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane has a molecular weight of 265.57 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2-(2,3-dichlorophenyl)oxolane is sourced from PubChem (CID 79372823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).