About 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane
3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane (PubChem CID 79373429) has the molecular formula C11H15ClOS
and a molecular weight of 230.76 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane |
| PubChem CID | 79373429 |
| Molecular Formula | C11H15ClOS |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane |
| SMILES | Cc1cc(C2OCCC2CCl)c(C)s1 |
| InChI | InChI=1S/C11H15ClOS/c1-7-5-10(8(2)14-7)11-9(6-12)3-4-13-11/h5,9,11H,3-4,6H2,1-2H3 |
| InChIKey | OFFOQCYVTFHCJJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane?
The IUPAC name of 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane (CID 79373429) is 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane.
What is the SMILES notation for 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane?
The canonical SMILES for 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane is Cc1cc(C2OCCC2CCl)c(C)s1.
What is the InChIKey of 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane?
The InChIKey is OFFOQCYVTFHCJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClOS/c1-7-5-10(8(2)14-7)11-9(6-12)3-4-13-11/h5,9,11H,3-4,6H2,1-2H3.
What are the key properties of 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane?
3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane has a molecular weight of 230.76 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2-(2,5-dimethylthiophen-3-yl)oxolane is sourced from PubChem (CID 79373429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).