About 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile
8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile (PubChem CID 79374586) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
| PubChem CID | 79374586 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
| SMILES | COc1ccc2c(c1)-c1[nH]c(=O)c(C#N)cc1C2 |
| InChI | InChI=1S/C14H10N2O2/c1-18-11-3-2-8-4-9-5-10(7-15)14(17)16-13(9)12(8)6-11/h2-3,5-6H,4H2,1H3,(H,16,17) |
| InChIKey | IRGFVIFZWOCOHT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
The IUPAC name of 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile (CID 79374586) is 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile.
What is the SMILES notation for 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
The canonical SMILES for 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile is COc1ccc2c(c1)-c1[nH]c(=O)c(C#N)cc1C2.
What is the InChIKey of 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
The InChIKey is IRGFVIFZWOCOHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c1-18-11-3-2-8-4-9-5-10(7-15)14(17)16-13(9)12(8)6-11/h2-3,5-6H,4H2,1H3,(H,16,17).
What are the key properties of 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile?
8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile has a molecular weight of 238.25 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-2-oxo-1,5-dihydroindeno[1,2-b]pyridine-3-carbonitrile is sourced from PubChem (CID 79374586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).