C12H17NO3S — CID 79374666
2-ethylsulfonyl-6-methoxy-2,3-dihydro-1H-inden-1-amine (PubChem CID 79374666) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-ethylsulfonyl-6-methoxy-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2-ethylsulfonyl-6-methoxy-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 79374666 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-ethylsulfonyl-6-methoxy-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCS(=O)(=O)C1Cc2ccc(OC)cc2C1N |
| InChI | InChI=1S/C12H17NO3S/c1-3-17(14,15)11-6-8-4-5-9(16-2)7-10(8)12(11)13/h4-5,7,11-12H,3,6,13H2,1-2H3 |
| InChIKey | FASZJTYVADXBAF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |