About 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone
1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone (PubChem CID 79375410) has the molecular formula C12H10F2N2OS
and a molecular weight of 268.29 g/mol. Its IUPAC name is 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone |
| PubChem CID | 79375410 |
| Molecular Formula | C12H10F2N2OS |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1c(C)nsc1Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H10F2N2OS/c1-6-11(7(2)17)12(18-16-6)15-10-4-8(13)3-9(14)5-10/h3-5,15H,1-2H3 |
| InChIKey | VGDLAYSUWDEHGZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone?
The IUPAC name of 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone (CID 79375410) is 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone.
What is the SMILES notation for 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone?
The canonical SMILES for 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone is CC(=O)c1c(C)nsc1Nc1cc(F)cc(F)c1.
What is the InChIKey of 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone?
The InChIKey is VGDLAYSUWDEHGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2OS/c1-6-11(7(2)17)12(18-16-6)15-10-4-8(13)3-9(14)5-10/h3-5,15H,1-2H3.
What are the key properties of 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone?
1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone has a molecular weight of 268.29 g/mol, XLogP of 3.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3,5-difluoroanilino)-3-methyl-1,2-thiazol-4-yl]ethanone is sourced from PubChem (CID 79375410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).