C15H19F2NO3 — CID 79376828
1-[1-[2-(difluoromethoxy)phenyl]ethyl]-2-methylpyrrolidine-3-carboxylic acid (PubChem CID 79376828) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]ethyl]-2-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]ethyl]-2-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 79376828 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]ethyl]-2-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC(c1ccccc1OC(F)F)N1CCC(C(=O)O)C1C |
| InChI | InChI=1S/C15H19F2NO3/c1-9(18-8-7-12(10(18)2)14(19)20)11-5-3-4-6-13(11)21-15(16)17/h3-6,9-10,12,15H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | ICEUHVFKPLEWCH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |