About 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol
3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol (PubChem CID 79377499) has the molecular formula C11H25NO2
and a molecular weight of 203.33 g/mol. Its IUPAC name is 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol |
| PubChem CID | 79377499 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol |
| SMILES | CCN(CC(C)(C)O)CC(C)(C)CO |
| InChI | InChI=1S/C11H25NO2/c1-6-12(8-11(4,5)14)7-10(2,3)9-13/h13-14H,6-9H2,1-5H3 |
| InChIKey | OPRQMIOXGYYAIX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol (CID 79377499) is 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol is CCN(CC(C)(C)O)CC(C)(C)CO.
What is the InChIKey of 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol?
The InChIKey is OPRQMIOXGYYAIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO2/c1-6-12(8-11(4,5)14)7-10(2,3)9-13/h13-14H,6-9H2,1-5H3.
What are the key properties of 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol?
3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol has a molecular weight of 203.33 g/mol, XLogP of 1.10, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 79377499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).