C13H28N2O2 — CID 79377535
3-(tert-butylamino)-N-ethyl-N-(2-hydroxy-2-methylpropyl)propanamide (PubChem CID 79377535) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-(tert-butylamino)-N-ethyl-N-(2-hydroxy-2-methylpropyl)propanamide.
| Compound Name | 3-(tert-butylamino)-N-ethyl-N-(2-hydroxy-2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 79377535 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 3-(tert-butylamino)-N-ethyl-N-(2-hydroxy-2-methylpropyl)propanamide |
| SMILES | CCN(CC(C)(C)O)C(=O)CCNC(C)(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-7-15(10-13(5,6)17)11(16)8-9-14-12(2,3)4/h14,17H,7-10H2,1-6H3 |
| InChIKey | QBGRHHZDEBYPQS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |