C15H21N3O3 — CID 79378028
4-[[2-(3-aminophenoxy)acetyl]amino]-N-cyclopropylbutanamide (PubChem CID 79378028) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-[[2-(3-aminophenoxy)acetyl]amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[[2-(3-aminophenoxy)acetyl]amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 79378028 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4-[[2-(3-aminophenoxy)acetyl]amino]-N-cyclopropylbutanamide |
| SMILES | Nc1cccc(OCC(=O)NCCCC(=O)NC2CC2)c1 |
| InChI | InChI=1S/C15H21N3O3/c16-11-3-1-4-13(9-11)21-10-15(20)17-8-2-5-14(19)18-12-6-7-12/h1,3-4,9,12H,2,5-8,10,16H2,(H,17,20)(H,18,19) |
| InChIKey | ZAUQOQBQEWOZSP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|