C10H22N2O2 — CID 79378283
N-ethyl-N-(2-hydroxy-2-methylpropyl)-2-(methylamino)propanamide (PubChem CID 79378283) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxy-2-methylpropyl)-2-(methylamino)propanamide.
| Compound Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 79378283 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)-2-(methylamino)propanamide |
| SMILES | CCN(CC(C)(C)O)C(=O)C(C)NC |
| InChI | InChI=1S/C10H22N2O2/c1-6-12(7-10(3,4)14)9(13)8(2)11-5/h8,11,14H,6-7H2,1-5H3 |
| InChIKey | DICHJFDFNRELLX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |