C15H11NO4 — CID 793808
12,12-dimethyl-3,11,14-trioxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),5,8,13(17),15-hexaen-4-one (PubChem CID 793808) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 12,12-dimethyl-3,11,14-trioxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),5,8,13(17),15-hexaen-4-one.
| Compound Name | 12,12-dimethyl-3,11,14-trioxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),5,8,13(17),15-hexaen-4-one |
|---|---|
| PubChem CID | 793808 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 12,12-dimethyl-3,11,14-trioxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),5,8,13(17),15-hexaen-4-one |
| SMILES | CC1(C)Oc2ccc3ccc(=O)oc3c2-c2cnoc21 |
| InChI | InChI=1S/C15H11NO4/c1-15(2)14-9(7-16-20-14)12-10(19-15)5-3-8-4-6-11(17)18-13(8)12/h3-7H,1-2H3 |
| InChIKey | WEMRYTUZPHFMIQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|