C11H20N4O2 — CID 79384969
4-amino-N-ethyl-N-(2-hydroxy-2-methylpropyl)-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 79384969) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 4-amino-N-ethyl-N-(2-hydroxy-2-methylpropyl)-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-ethyl-N-(2-hydroxy-2-methylpropyl)-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 79384969 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4-amino-N-ethyl-N-(2-hydroxy-2-methylpropyl)-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | CCN(CC(C)(C)O)C(=O)c1n[nH]c(C)c1N |
| InChI | InChI=1S/C11H20N4O2/c1-5-15(6-11(3,4)17)10(16)9-8(12)7(2)13-14-9/h17H,5-6,12H2,1-4H3,(H,13,14) |
| InChIKey | KGHHVBIFTFAPSI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |