C12H19NO4 — CID 79386693
5-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 79386693) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 79386693 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 5-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CN(C)CC(C)(C)O)cc1C(=O)O |
| InChI | InChI=1S/C12H19NO4/c1-8-10(11(14)15)5-9(17-8)6-13(4)7-12(2,3)16/h5,16H,6-7H2,1-4H3,(H,14,15) |
| InChIKey | MHYLUTWFZBPBNI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |