methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate

C10H10N4O2S — CID 793874

IUPACmethyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate
SMILESCOC(=O)CSc1nnnn1-c1ccccc1
InChIInChI=1S/C10H10N4O2S/c1-16-9(15)7-17-10-11-12-13-14(10)8-5-3-2-4-6-8/h2-6H,7H2,1H3
InChIKeyWLAIWLWNUGVBEF-UHFFFAOYSA-N
MW250.28 g/mol
LogP0.93
Rot. Bonds4

About methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate

methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate (PubChem CID 793874) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate.

Molecular Properties

Compound Namemethyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate
PubChem CID793874
Molecular FormulaC10H10N4O2S
Molecular Weight250.28 g/mol
Exact Mass250.05
IUPAC Namemethyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate
SMILESCOC(=O)CSc1nnnn1-c1ccccc1
InChIInChI=1S/C10H10N4O2S/c1-16-9(15)7-17-10-11-12-13-14(10)8-5-3-2-4-6-8/h2-6H,7H2,1H3
InChIKeyWLAIWLWNUGVBEF-UHFFFAOYSA-N
XLogP0.93
TPSA69.90 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.28
LogP ≤ 50.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate?
The IUPAC name of methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate (CID 793874) is methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate.
What is the SMILES notation for methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate?
The canonical SMILES for methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate is COC(=O)CSc1nnnn1-c1ccccc1.
What is the InChIKey of methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate?
The InChIKey is WLAIWLWNUGVBEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2S/c1-16-9(15)7-17-10-11-12-13-14(10)8-5-3-2-4-6-8/h2-6H,7H2,1H3.
What are the key properties of methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate?
methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate has a molecular weight of 250.28 g/mol, XLogP of 0.93, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-phenyltetrazol-5-yl)sulfanylacetate is sourced from PubChem (CID 793874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).