C10H24N2O3S — CID 79387885
1-[ethyl-[methyl(propan-2-yl)sulfamoyl]amino]-2-methylpropan-2-ol (PubChem CID 79387885) has the molecular formula C10H24N2O3S and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-[ethyl-[methyl(propan-2-yl)sulfamoyl]amino]-2-methylpropan-2-ol.
| Compound Name | 1-[ethyl-[methyl(propan-2-yl)sulfamoyl]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 79387885 |
| Molecular Formula | C10H24N2O3S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-[ethyl-[methyl(propan-2-yl)sulfamoyl]amino]-2-methylpropan-2-ol |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)N(C)C(C)C |
| InChI | InChI=1S/C10H24N2O3S/c1-7-12(8-10(4,5)13)16(14,15)11(6)9(2)3/h9,13H,7-8H2,1-6H3 |
| InChIKey | REXVOGWQRSUIFN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |