C9H16N2O3 — CID 79388540
2-[(2-methylpyrrolidine-3-carbonyl)amino]propanoic acid (PubChem CID 79388540) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-[(2-methylpyrrolidine-3-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(2-methylpyrrolidine-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 79388540 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-[(2-methylpyrrolidine-3-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)C1CCNC1C)C(=O)O |
| InChI | InChI=1S/C9H16N2O3/c1-5-7(3-4-10-5)8(12)11-6(2)9(13)14/h5-7,10H,3-4H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | GPRSWUWEBUBVNU-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |