C10H19N3O2 — CID 79388729
N-[2-(ethylamino)-2-oxoethyl]-2-methylpyrrolidine-3-carboxamide (PubChem CID 79388729) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-[2-(ethylamino)-2-oxoethyl]-2-methylpyrrolidine-3-carboxamide.
| Compound Name | N-[2-(ethylamino)-2-oxoethyl]-2-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 79388729 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-[2-(ethylamino)-2-oxoethyl]-2-methylpyrrolidine-3-carboxamide |
| SMILES | CCNC(=O)CNC(=O)C1CCNC1C |
| InChI | InChI=1S/C10H19N3O2/c1-3-11-9(14)6-13-10(15)8-4-5-12-7(8)2/h7-8,12H,3-6H2,1-2H3,(H,11,14)(H,13,15) |
| InChIKey | OAFGEWLBKWODLF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |