C11H19N3O — CID 79389256
N-(2-cyanopropyl)-N,2-dimethylpyrrolidine-3-carboxamide (PubChem CID 79389256) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(2-cyanopropyl)-N,2-dimethylpyrrolidine-3-carboxamide.
| Compound Name | N-(2-cyanopropyl)-N,2-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 79389256 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-(2-cyanopropyl)-N,2-dimethylpyrrolidine-3-carboxamide |
| SMILES | CC(C#N)CN(C)C(=O)C1CCNC1C |
| InChI | InChI=1S/C11H19N3O/c1-8(6-12)7-14(3)11(15)10-4-5-13-9(10)2/h8-10,13H,4-5,7H2,1-3H3 |
| InChIKey | OMAVBIPLQIRKSH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |