About 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol
1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol (PubChem CID 79389539) has the molecular formula C12H26BrNO
and a molecular weight of 280.25 g/mol. Its IUPAC name is 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol |
| PubChem CID | 79389539 |
| Molecular Formula | C12H26BrNO |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol |
| SMILES | CN(CC(CBr)C(C)(C)C)CC(C)(C)O |
| InChI | InChI=1S/C12H26BrNO/c1-11(2,3)10(7-13)8-14(6)9-12(4,5)15/h10,15H,7-9H2,1-6H3 |
| InChIKey | YIVQFGSLQZCCPV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol?
The IUPAC name of 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol (CID 79389539) is 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol.
What is the SMILES notation for 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol?
The canonical SMILES for 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol is CN(CC(CBr)C(C)(C)C)CC(C)(C)O.
What is the InChIKey of 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol?
The InChIKey is YIVQFGSLQZCCPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26BrNO/c1-11(2,3)10(7-13)8-14(6)9-12(4,5)15/h10,15H,7-9H2,1-6H3.
What are the key properties of 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol?
1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol has a molecular weight of 280.25 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-2-methylpropan-2-ol is sourced from PubChem (CID 79389539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).