C10H25N3O3S — CID 79389735
1-[[3-aminopropyl(methyl)sulfamoyl]-ethylamino]-2-methylpropan-2-ol (PubChem CID 79389735) has the molecular formula C10H25N3O3S and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-[[3-aminopropyl(methyl)sulfamoyl]-ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[[3-aminopropyl(methyl)sulfamoyl]-ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 79389735 |
| Molecular Formula | C10H25N3O3S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-[[3-aminopropyl(methyl)sulfamoyl]-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)N(C)CCCN |
| InChI | InChI=1S/C10H25N3O3S/c1-5-13(9-10(2,3)14)17(15,16)12(4)8-6-7-11/h14H,5-9,11H2,1-4H3 |
| InChIKey | VQMASBSKYAYVRA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |