About 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide
3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide (PubChem CID 79389813) has the molecular formula C10H20ClNO2
and a molecular weight of 221.73 g/mol. Its IUPAC name is 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide |
| PubChem CID | 79389813 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide |
| SMILES | CN(CC(C)(C)O)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C10H20ClNO2/c1-9(2,6-11)8(13)12(5)7-10(3,4)14/h14H,6-7H2,1-5H3 |
| InChIKey | LJSPQPDWXYYLAV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide?
The IUPAC name of 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide (CID 79389813) is 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide.
What is the SMILES notation for 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide?
The canonical SMILES for 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide is CN(CC(C)(C)O)C(=O)C(C)(C)CCl.
What is the InChIKey of 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide?
The InChIKey is LJSPQPDWXYYLAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO2/c1-9(2,6-11)8(13)12(5)7-10(3,4)14/h14H,6-7H2,1-5H3.
What are the key properties of 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide?
3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide has a molecular weight of 221.73 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,2,2-trimethylpropanamide is sourced from PubChem (CID 79389813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).