C9H23N3O3S — CID 79390311
1-[[3-aminopropyl(methyl)sulfamoyl]-methylamino]-2-methylpropan-2-ol (PubChem CID 79390311) has the molecular formula C9H23N3O3S and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-[[3-aminopropyl(methyl)sulfamoyl]-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[[3-aminopropyl(methyl)sulfamoyl]-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 79390311 |
| Molecular Formula | C9H23N3O3S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-[[3-aminopropyl(methyl)sulfamoyl]-methylamino]-2-methylpropan-2-ol |
| SMILES | CN(CCCN)S(=O)(=O)N(C)CC(C)(C)O |
| InChI | InChI=1S/C9H23N3O3S/c1-9(2,13)8-12(4)16(14,15)11(3)7-5-6-10/h13H,5-8,10H2,1-4H3 |
| InChIKey | BKYQZSUERZRNGT-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |