About 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate
2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate (PubChem CID 79391240) has the molecular formula C10H16N2O3S
and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate |
| PubChem CID | 79391240 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate |
| SMILES | Cc1nsc(N)c1C(=O)OCCOC(C)C |
| InChI | InChI=1S/C10H16N2O3S/c1-6(2)14-4-5-15-10(13)8-7(3)12-16-9(8)11/h6H,4-5,11H2,1-3H3 |
| InChIKey | AKMKKAGVQADLRM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The IUPAC name of 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate (CID 79391240) is 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
What is the SMILES notation for 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The canonical SMILES for 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate is Cc1nsc(N)c1C(=O)OCCOC(C)C.
What is the InChIKey of 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The InChIKey is AKMKKAGVQADLRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3S/c1-6(2)14-4-5-15-10(13)8-7(3)12-16-9(8)11/h6H,4-5,11H2,1-3H3.
What are the key properties of 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate has a molecular weight of 244.32 g/mol, XLogP of 1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyethyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 79391240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).