About cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate
cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate (PubChem CID 79392094) has the molecular formula C11H16N2O2S
and a molecular weight of 240.33 g/mol. Its IUPAC name is cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate |
| PubChem CID | 79392094 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate |
| SMILES | Cc1nsc(N)c1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C11H16N2O2S/c1-7-9(10(12)16-13-7)11(14)15-8-5-3-2-4-6-8/h8H,2-6,12H2,1H3 |
| InChIKey | SKRDYCAMPZNVPY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The IUPAC name of cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate (CID 79392094) is cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
What is the SMILES notation for cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The canonical SMILES for cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate is Cc1nsc(N)c1C(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The InChIKey is SKRDYCAMPZNVPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-7-9(10(12)16-13-7)11(14)15-8-5-3-2-4-6-8/h8H,2-6,12H2,1H3.
What are the key properties of cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate has a molecular weight of 240.33 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 5-amino-3-methyl-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 79392094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).