C11H16N4O2S — CID 79392515
4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-N,3-dimethyl-1,2-thiazol-5-amine (PubChem CID 79392515) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-N,3-dimethyl-1,2-thiazol-5-amine.
| Compound Name | 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-N,3-dimethyl-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 79392515 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]-N,3-dimethyl-1,2-thiazol-5-amine |
| SMILES | CNc1snc(C)c1-c1nc(CCCOC)no1 |
| InChI | InChI=1S/C11H16N4O2S/c1-7-9(11(12-2)18-15-7)10-13-8(14-17-10)5-4-6-16-3/h12H,4-6H2,1-3H3 |
| InChIKey | ICMQUUVSYWIDCG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|