C12H15F3N2OS — CID 79392963
2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-4-propan-2-yl-1,3-thiazole-5-carbaldehyde (PubChem CID 79392963) has the molecular formula C12H15F3N2OS and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-4-propan-2-yl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-4-propan-2-yl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 79392963 |
| Molecular Formula | C12H15F3N2OS |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-4-propan-2-yl-1,3-thiazole-5-carbaldehyde |
| SMILES | CC(C)c1nc(N(CC(F)(F)F)C2CC2)sc1C=O |
| InChI | InChI=1S/C12H15F3N2OS/c1-7(2)10-9(5-18)19-11(16-10)17(8-3-4-8)6-12(13,14)15/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | YLZAIGPQAWJMEL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|