C13H25N3O2 — CID 79394119
N-cyclopropyl-3-[[2-oxo-2-(pentan-2-ylamino)ethyl]amino]propanamide (PubChem CID 79394119) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-cyclopropyl-3-[[2-oxo-2-(pentan-2-ylamino)ethyl]amino]propanamide.
| Compound Name | N-cyclopropyl-3-[[2-oxo-2-(pentan-2-ylamino)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 79394119 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N-cyclopropyl-3-[[2-oxo-2-(pentan-2-ylamino)ethyl]amino]propanamide |
| SMILES | CCCC(C)NC(=O)CNCCC(=O)NC1CC1 |
| InChI | InChI=1S/C13H25N3O2/c1-3-4-10(2)15-13(18)9-14-8-7-12(17)16-11-5-6-11/h10-11,14H,3-9H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | ODRUZQJDVGMKJI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|