About N,N'-dicyclohexyl-2-nitropropane-1,3-diimine
N,N'-dicyclohexyl-2-nitropropane-1,3-diimine (PubChem CID 793958) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is N,N'-dicyclohexyl-2-nitropropane-1,3-diimine.
Molecular Properties
| Compound Name | N,N'-dicyclohexyl-2-nitropropane-1,3-diimine |
| PubChem CID | 793958 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N,N'-dicyclohexyl-2-nitropropane-1,3-diimine |
| SMILES | O=[N+]([O-])C(/C=N/C1CCCCC1)/C=N/C1CCCCC1 |
| InChI | InChI=1S/C15H25N3O2/c19-18(20)15(11-16-13-7-3-1-4-8-13)12-17-14-9-5-2-6-10-14/h11-15H,1-10H2/b16-11+,17-12+ |
| InChIKey | YKJFBVKYFHOGSB-MAEUFBSDSA-N |
| XLogP | 3.44 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dicyclohexyl-2-nitropropane-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dicyclohexyl-2-nitropropane-1,3-diimine?
The IUPAC name of N,N'-dicyclohexyl-2-nitropropane-1,3-diimine (CID 793958) is N,N'-dicyclohexyl-2-nitropropane-1,3-diimine.
What is the SMILES notation for N,N'-dicyclohexyl-2-nitropropane-1,3-diimine?
The canonical SMILES for N,N'-dicyclohexyl-2-nitropropane-1,3-diimine is O=[N+]([O-])C(/C=N/C1CCCCC1)/C=N/C1CCCCC1.
What is the InChIKey of N,N'-dicyclohexyl-2-nitropropane-1,3-diimine?
The InChIKey is YKJFBVKYFHOGSB-MAEUFBSDSA-N. The full InChI is InChI=1S/C15H25N3O2/c19-18(20)15(11-16-13-7-3-1-4-8-13)12-17-14-9-5-2-6-10-14/h11-15H,1-10H2/b16-11+,17-12+.
What are the key properties of N,N'-dicyclohexyl-2-nitropropane-1,3-diimine?
N,N'-dicyclohexyl-2-nitropropane-1,3-diimine has a molecular weight of 279.38 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dicyclohexyl-2-nitropropane-1,3-diimine is sourced from PubChem (CID 793958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).