About 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one
3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one (PubChem CID 79396198) has the molecular formula C11H19F3N2O
and a molecular weight of 252.28 g/mol. Its IUPAC name is 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one.
Molecular Properties
| Compound Name | 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one |
| PubChem CID | 79396198 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one |
| SMILES | CC(C)C(=O)CN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3N2O/c1-9(2)10(17)7-15-3-5-16(6-4-15)8-11(12,13)14/h9H,3-8H2,1-2H3 |
| InChIKey | JYPBDCVKKVBDLM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one?
The IUPAC name of 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one (CID 79396198) is 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one.
What is the SMILES notation for 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one?
The canonical SMILES for 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one is CC(C)C(=O)CN1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one?
The InChIKey is JYPBDCVKKVBDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O/c1-9(2)10(17)7-15-3-5-16(6-4-15)8-11(12,13)14/h9H,3-8H2,1-2H3.
What are the key properties of 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one?
3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one has a molecular weight of 252.28 g/mol, XLogP of 1.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-2-one is sourced from PubChem (CID 79396198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).