C15H22F2N2 — CID 79397433
1-(2,6-difluorophenyl)-N-ethyl-2,3-dimethylpiperidin-4-amine (PubChem CID 79397433) has the molecular formula C15H22F2N2 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-ethyl-2,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(2,6-difluorophenyl)-N-ethyl-2,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 79397433 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-ethyl-2,3-dimethylpiperidin-4-amine |
| SMILES | CCNC1CCN(c2c(F)cccc2F)C(C)C1C |
| InChI | InChI=1S/C15H22F2N2/c1-4-18-14-8-9-19(11(3)10(14)2)15-12(16)6-5-7-13(15)17/h5-7,10-11,14,18H,4,8-9H2,1-3H3 |
| InChIKey | MOLWKXVERZHSGJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |