About 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid
5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 79397478) has the molecular formula C13H10Cl2N2O3S
and a molecular weight of 345.21 g/mol. Its IUPAC name is 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid |
| PubChem CID | 79397478 |
| Molecular Formula | C13H10Cl2N2O3S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(N(C)C(=O)c2ccc(Cl)cc2Cl)c1C(=O)O |
| InChI | InChI=1S/C13H10Cl2N2O3S/c1-6-10(13(19)20)12(21-16-6)17(2)11(18)8-4-3-7(14)5-9(8)15/h3-5H,1-2H3,(H,19,20) |
| InChIKey | MJFLGGFWPXDQTE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid (CID 79397478) is 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid is Cc1nsc(N(C)C(=O)c2ccc(Cl)cc2Cl)c1C(=O)O.
What is the InChIKey of 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid?
The InChIKey is MJFLGGFWPXDQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O3S/c1-6-10(13(19)20)12(21-16-6)17(2)11(18)8-4-3-7(14)5-9(8)15/h3-5H,1-2H3,(H,19,20).
What are the key properties of 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid?
5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid has a molecular weight of 345.21 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-dichlorobenzoyl)-methylamino]-3-methyl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 79397478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).