C11H13F3N2O4S — CID 79397796
3-methyl-5-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]-1,2-thiazole-4-carboxylic acid (PubChem CID 79397796) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-methyl-5-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-methyl-5-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79397796 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-methyl-5-[methyl-[3-(2,2,2-trifluoroethoxy)propanoyl]amino]-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(N(C)C(=O)CCOCC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C11H13F3N2O4S/c1-6-8(10(18)19)9(21-15-6)16(2)7(17)3-4-20-5-11(12,13)14/h3-5H2,1-2H3,(H,18,19) |
| InChIKey | XUVFMBLBZLNFJB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|