C17H28N2 — CID 79397861
2,3-dimethyl-1-(4-methylphenyl)-N-propylpiperidin-4-amine (PubChem CID 79397861) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 2,3-dimethyl-1-(4-methylphenyl)-N-propylpiperidin-4-amine.
| Compound Name | 2,3-dimethyl-1-(4-methylphenyl)-N-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 79397861 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2,3-dimethyl-1-(4-methylphenyl)-N-propylpiperidin-4-amine |
| SMILES | CCCNC1CCN(c2ccc(C)cc2)C(C)C1C |
| InChI | InChI=1S/C17H28N2/c1-5-11-18-17-10-12-19(15(4)14(17)3)16-8-6-13(2)7-9-16/h6-9,14-15,17-18H,5,10-12H2,1-4H3 |
| InChIKey | MTCVPCQJMUNBMD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|