C12H13Cl2N3O2S — CID 79397969
methyl 3-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2-methylbutanoate (PubChem CID 79397969) has the molecular formula C12H13Cl2N3O2S and a molecular weight of 334.23 g/mol. Its IUPAC name is methyl 3-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2-methylbutanoate.
| Compound Name | methyl 3-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2-methylbutanoate |
|---|---|
| PubChem CID | 79397969 |
| Molecular Formula | C12H13Cl2N3O2S |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | methyl 3-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2-methylbutanoate |
| SMILES | COC(=O)C(C)C(C)Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C12H13Cl2N3O2S/c1-5(12(18)19-3)6(2)15-9-7(13)4-8(14)10-11(9)17-20-16-10/h4-6,15H,1-3H3 |
| InChIKey | FFRBXFDKLWTJGI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |