About 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine
4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine (PubChem CID 79398671) has the molecular formula C7H6BrN3S
and a molecular weight of 244.12 g/mol. Its IUPAC name is 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine |
| PubChem CID | 79398671 |
| Molecular Formula | C7H6BrN3S |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine |
| SMILES | Brc1csc(Nn2cccc2)n1 |
| InChI | InChI=1S/C7H6BrN3S/c8-6-5-12-7(9-6)10-11-3-1-2-4-11/h1-5H,(H,9,10) |
| InChIKey | AOAWJILYMBMRRO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine?
The IUPAC name of 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine (CID 79398671) is 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine?
The canonical SMILES for 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine is Brc1csc(Nn2cccc2)n1.
What is the InChIKey of 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine?
The InChIKey is AOAWJILYMBMRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3S/c8-6-5-12-7(9-6)10-11-3-1-2-4-11/h1-5H,(H,9,10).
What are the key properties of 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine?
4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine has a molecular weight of 244.12 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-pyrrol-1-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 79398671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).