About 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine
3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine (PubChem CID 79398738) has the molecular formula C9H8BrN3S
and a molecular weight of 270.16 g/mol. Its IUPAC name is 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine |
| PubChem CID | 79398738 |
| Molecular Formula | C9H8BrN3S |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 268.96 |
| IUPAC Name | 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2nc(Br)cs2)c1 |
| InChI | InChI=1S/C9H8BrN3S/c10-8-5-14-9(13-8)12-7-3-1-2-6(11)4-7/h1-5H,11H2,(H,12,13) |
| InChIKey | NOXIUKUAUPLMHM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine?
The IUPAC name of 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine (CID 79398738) is 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine.
What is the SMILES notation for 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine?
The canonical SMILES for 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine is Nc1cccc(Nc2nc(Br)cs2)c1.
What is the InChIKey of 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine?
The InChIKey is NOXIUKUAUPLMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3S/c10-8-5-14-9(13-8)12-7-3-1-2-6(11)4-7/h1-5H,11H2,(H,12,13).
What are the key properties of 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine?
3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine has a molecular weight of 270.16 g/mol, XLogP of 3.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(4-bromo-1,3-thiazol-2-yl)benzene-1,3-diamine is sourced from PubChem (CID 79398738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).