About 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine
1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine (PubChem CID 79398794) has the molecular formula C11H18BrN3S
and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine |
| PubChem CID | 79398794 |
| Molecular Formula | C11H18BrN3S |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCN(c2nc(Br)cs2)CC1 |
| InChI | InChI=1S/C11H18BrN3S/c1-14(2)7-9-3-5-15(6-4-9)11-13-10(12)8-16-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | ZYCYBCDTMYIGBR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine (CID 79398794) is 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine is CN(C)CC1CCN(c2nc(Br)cs2)CC1.
What is the InChIKey of 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine?
The InChIKey is ZYCYBCDTMYIGBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BrN3S/c1-14(2)7-9-3-5-15(6-4-9)11-13-10(12)8-16-11/h8-9H,3-7H2,1-2H3.
What are the key properties of 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine?
1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine has a molecular weight of 304.26 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 79398794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).