About 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile
2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile (PubChem CID 79398849) has the molecular formula C10H13BrN4S
and a molecular weight of 301.21 g/mol. Its IUPAC name is 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile |
| PubChem CID | 79398849 |
| Molecular Formula | C10H13BrN4S |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CCC(Nc2nc(Br)cs2)CC1 |
| InChI | InChI=1S/C10H13BrN4S/c11-9-7-16-10(14-9)13-8-1-4-15(5-2-8)6-3-12/h7-8H,1-2,4-6H2,(H,13,14) |
| InChIKey | BNLAORPWUAOFPW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile?
The IUPAC name of 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile (CID 79398849) is 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile.
What is the SMILES notation for 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile?
The canonical SMILES for 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile is N#CCN1CCC(Nc2nc(Br)cs2)CC1.
What is the InChIKey of 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile?
The InChIKey is BNLAORPWUAOFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN4S/c11-9-7-16-10(14-9)13-8-1-4-15(5-2-8)6-3-12/h7-8H,1-2,4-6H2,(H,13,14).
What are the key properties of 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile?
2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile has a molecular weight of 301.21 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-bromo-1,3-thiazol-2-yl)amino]piperidin-1-yl]acetonitrile is sourced from PubChem (CID 79398849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).