C11H17BrN2O2S — CID 79399334
6-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylheptanoic acid (PubChem CID 79399334) has the molecular formula C11H17BrN2O2S and a molecular weight of 321.24 g/mol. Its IUPAC name is 6-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylheptanoic acid.
| Compound Name | 6-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 79399334 |
| Molecular Formula | C11H17BrN2O2S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 6-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylheptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)Nc1nc(Br)cs1 |
| InChI | InChI=1S/C11H17BrN2O2S/c1-7(10(15)16)4-3-5-8(2)13-11-14-9(12)6-17-11/h6-8H,3-5H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | CFVZGTWMWIHJRY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |