About 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide
4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide (PubChem CID 79399639) has the molecular formula C7H9BrN2O2S2
and a molecular weight of 297.20 g/mol. Its IUPAC name is 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 79399639 |
| Molecular Formula | C7H9BrN2O2S2 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 295.93 |
| IUPAC Name | 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(c2nc(Br)cs2)CC1 |
| InChI | InChI=1S/C7H9BrN2O2S2/c8-6-5-13-7(9-6)10-1-3-14(11,12)4-2-10/h5H,1-4H2 |
| InChIKey | FFUMCSPJBCVBTC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide (CID 79399639) is 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide is O=S1(=O)CCN(c2nc(Br)cs2)CC1.
What is the InChIKey of 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide?
The InChIKey is FFUMCSPJBCVBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2O2S2/c8-6-5-13-7(9-6)10-1-3-14(11,12)4-2-10/h5H,1-4H2.
What are the key properties of 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide?
4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide has a molecular weight of 297.20 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-1,3-thiazol-2-yl)-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 79399639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).