About 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole
2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole (PubChem CID 79400057) has the molecular formula C5H2BrN3S3
and a molecular weight of 280.20 g/mol. Its IUPAC name is 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole |
| PubChem CID | 79400057 |
| Molecular Formula | C5H2BrN3S3 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 278.86 |
| IUPAC Name | 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole |
| SMILES | Brc1csc(Sc2nncs2)n1 |
| InChI | InChI=1S/C5H2BrN3S3/c6-3-1-10-4(8-3)12-5-9-7-2-11-5/h1-2H |
| InChIKey | NAPMCKOWGOMKCK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole?
The IUPAC name of 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole (CID 79400057) is 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole.
What is the SMILES notation for 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole?
The canonical SMILES for 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole is Brc1csc(Sc2nncs2)n1.
What is the InChIKey of 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole?
The InChIKey is NAPMCKOWGOMKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2BrN3S3/c6-3-1-10-4(8-3)12-5-9-7-2-11-5/h1-2H.
What are the key properties of 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole?
2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole has a molecular weight of 280.20 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole is sourced from PubChem (CID 79400057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).