C18H25NO — CID 794004
1-[(3R,4aR,9aR)-3,9,9-trimethyl-1,2,3,4,4a,9a-hexahydroacridin-10-yl]ethanone (PubChem CID 794004) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 1-[(3R,4aR,9aR)-3,9,9-trimethyl-1,2,3,4,4a,9a-hexahydroacridin-10-yl]ethanone.
| Compound Name | 1-[(3R,4aR,9aR)-3,9,9-trimethyl-1,2,3,4,4a,9a-hexahydroacridin-10-yl]ethanone |
|---|---|
| PubChem CID | 794004 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1-[(3R,4aR,9aR)-3,9,9-trimethyl-1,2,3,4,4a,9a-hexahydroacridin-10-yl]ethanone |
| SMILES | CC(=O)N1c2ccccc2C(C)(C)[C@H]2CC[C@@H](C)C[C@H]21 |
| InChI | InChI=1S/C18H25NO/c1-12-9-10-15-17(11-12)19(13(2)20)16-8-6-5-7-14(16)18(15,3)4/h5-8,12,15,17H,9-11H2,1-4H3/t12-,15+,17-/m1/s1 |
| InChIKey | BNLNIDMXFUKQJC-ISTRZQFTSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |