About 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid
5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 79402935) has the molecular formula C12H16N4O2S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid |
| PubChem CID | 79402935 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(NCCCCn2ccnc2)c1C(=O)O |
| InChI | InChI=1S/C12H16N4O2S/c1-9-10(12(17)18)11(19-15-9)14-4-2-3-6-16-7-5-13-8-16/h5,7-8,14H,2-4,6H2,1H3,(H,17,18) |
| InChIKey | JHYBQHRKMFJFPX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid (CID 79402935) is 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid is Cc1nsc(NCCCCn2ccnc2)c1C(=O)O.
What is the InChIKey of 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid?
The InChIKey is JHYBQHRKMFJFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S/c1-9-10(12(17)18)11(19-15-9)14-4-2-3-6-16-7-5-13-8-16/h5,7-8,14H,2-4,6H2,1H3,(H,17,18).
What are the key properties of 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid?
5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid has a molecular weight of 280.35 g/mol, XLogP of 2.24, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-imidazol-1-ylbutylamino)-3-methyl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 79402935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).