C17H16N4O3S — CID 7940339
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethanone (PubChem CID 7940339) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethanone.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 7940339 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethanone |
| SMILES | Cc1cc(C)n2c(SCC(=O)c3ccc4c(c3)OCCO4)nnc2n1 |
| InChI | InChI=1S/C17H16N4O3S/c1-10-7-11(2)21-16(18-10)19-20-17(21)25-9-13(22)12-3-4-14-15(8-12)24-6-5-23-14/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | DKDGJXOUCQCLBC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |