About 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one
1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one (PubChem CID 79404216) has the molecular formula C8H15NO3S
and a molecular weight of 205.28 g/mol. Its IUPAC name is 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one |
| PubChem CID | 79404216 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one |
| SMILES | CSCCC(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C8H15NO3S/c1-13-3-2-8(12)9-4-6(10)7(11)5-9/h6-7,10-11H,2-5H2,1H3/t6-,7+ |
| InChIKey | ZMDHTLBGARYHTN-KNVOCYPGSA-N |
| XLogP | -0.70 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one?
The IUPAC name of 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one (CID 79404216) is 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one.
What is the SMILES notation for 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one?
The canonical SMILES for 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one is CSCCC(=O)N1C[C@@H](O)[C@@H](O)C1.
What is the InChIKey of 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one?
The InChIKey is ZMDHTLBGARYHTN-KNVOCYPGSA-N. The full InChI is InChI=1S/C8H15NO3S/c1-13-3-2-8(12)9-4-6(10)7(11)5-9/h6-7,10-11H,2-5H2,1H3/t6-,7+.
What are the key properties of 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one?
1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one has a molecular weight of 205.28 g/mol, XLogP of -0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methylsulfanylpropan-1-one is sourced from PubChem (CID 79404216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).