C14H18Br2N2O3 — CID 79406188
1-(1,4-diazepan-1-yl)-2-(2,5-dibromo-4-methoxyphenoxy)ethanone (PubChem CID 79406188) has the molecular formula C14H18Br2N2O3 and a molecular weight of 422.12 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-(2,5-dibromo-4-methoxyphenoxy)ethanone.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-(2,5-dibromo-4-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 79406188 |
| Molecular Formula | C14H18Br2N2O3 |
| Molecular Weight | 422.12 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-(2,5-dibromo-4-methoxyphenoxy)ethanone |
| SMILES | COc1cc(Br)c(OCC(=O)N2CCCNCC2)cc1Br |
| InChI | InChI=1S/C14H18Br2N2O3/c1-20-12-7-11(16)13(8-10(12)15)21-9-14(19)18-5-2-3-17-4-6-18/h7-8,17H,2-6,9H2,1H3 |
| InChIKey | MRFZQMNGPGKJMY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |